What is the molecular formula of 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt?
The molecular formula is C4H2N4Na2O4.
What are the synonyms of 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt?
The synonyms are 96898-32-7 Disodium 1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxylate, Sodium 1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxylate, 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid.
What is the molecular weight of 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt?
The molecular weight is 216.06 g/mol.
What is the IUPAC name of 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt?
The IUPAC name is disodium;1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxylate.
What is the InChI of 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt?
The InChI is InChI=1S/C4H4N4O4.2Na/c9-3(10)1-5-7-2(4(11)12)8-6-1;;/h(H,5,6)(H,7,8)(H,9,10)(H,11,12);;/q;2*+1/p-2.
What is the InChIKey of 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt?
The InChIKey is NEJQRCMKIAPUCX-UHFFFAOYSA-L.
What is the canonical SMILES of 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt?
The canonical SMILES is C1(=NNC(=NN1)C(=O)[O-])C(=O)[O-].[Na+].[Na+].
What is the CAS number of 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt?
The CAS number is 96898-32-7.
Is 1,4-Dihydro-[1,2,4,5]tetrazine-3,6-dicarboxylic acid, disodium salt a canonicalized compound?
Yes, it is canonicalized.
※ Please kindly note that our products are for research use only.
Download
![(R)-(-)-(2,2-Dimethyl-[1,3]-dioxolan-4-yl)-methylamine](https://resource.alfa-chemistry.com/structure/96894-67-6.gif)
![Hexahydrocyclopenta[c]pyrrol-5(1H)-one](https://resource.alfa-chemistry.com/structure/96896-09-2.gif)
![3-Amino-8-benzyl-8-azabicyclo[3.2.1]octane](https://resource.alfa-chemistry.com/structure/96901-92-7.gif)
