CAS
96304-57-3 Purity
---
96304-57-3 Purity
---
Shopping basket
Azelaic acid bis(p-isopropylbenzyl)ester
CAS
96310-16-6
Catalog Number
ACM96310166
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular weight of Azelaic acid bis(p-isopropylbenzyl)ester?
The molecular weight of Azelaic acid bis(p-isopropylbenzyl)ester is 452.6 g/mol.
What is the IUPAC name of Azelaic acid bis(p-isopropylbenzyl)ester?
The IUPAC name is bis[(4-propan-2-ylphenyl)methyl] nonanedioate.
What is the Canonical SMILES notation for Azelaic acid bis(p-isopropylbenzyl)ester?
The Canonical SMILES notation is CC(C)C1=CC=C(C=C1)COC(=O)CCCCCCCC(=O)OCC2=CC=C(C=C2)C(C)C.
How many hydrogen bond acceptor counts are there in Azelaic acid bis(p-isopropylbenzyl)ester?
There are 4 hydrogen bond acceptor counts.
What is the XLogP3-AA value for Azelaic acid bis(p-isopropylbenzyl)ester?
The XLogP3-AA value is 7.5.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the topological polar surface area of Azelaic acid bis(p-isopropylbenzyl)ester?
The topological polar surface area is 52.6 Ų.
How many rotatable bond counts are there in Azelaic acid bis(p-isopropylbenzyl)ester?
There are 16 rotatable bond counts.
What is the exact mass of Azelaic acid bis(p-isopropylbenzyl)ester?
The exact mass is 452.29265975 g/mol.
What is the formal charge of Azelaic acid bis(p-isopropylbenzyl)ester?
The formal charge is 0.
Please kindly note that our products are for research use only.
Recommended Products
CAS
96304-85-7 Purity
---
96304-85-7 Purity
---
