What is the molecular formula of Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The molecular formula is C11H17N3O3S.
What are the synonyms for Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The synonyms are 96134-80-4, N,N-diethyl-3-(hydrazinecarbonyl)benzene-1-sulfonamide, N,N-diethyl-3-(hydrazinecarbonyl)benzenesulfonamide, n,n-diethyl-3-hydrazinocarbonyl-benzenesulfonamide, and TimTec1_000839.
What is the molecular weight of Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The molecular weight is 271.34 g/mol.
What is the IUPAC name of Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The IUPAC name is N,N-diethyl-3-(hydrazinecarbonyl)benzenesulfonamide.
What is the InChI of Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The InChI is InChI=1S/C11H17N3O3S/c1-3-14(4-2)18(16,17)10-7-5-6-9(8-10)11(15)13-12/h5-8H,3-4,12H2,1-2H3,(H,13,15).
What is the InChIKey of Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The InChIkey is JVJRCNQOLBMRQX-UHFFFAOYSA-N.
What is the canonical SMILES of Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The canonical SMILES is CCN(CC)S(=O)(=O)C1=CC=CC(=C1)C(=O)NN.
What is the CAS number of Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The CAS number is 96134-80-4.
What is the XLogP3-AA value of Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide?
The XLogP3-AA value is 0.3.
Is Benzoic acid,3-[(diethylamino)sulfonyl]-,hydrazide a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.