What is the molecular formula of styrene oxide?
The molecular formula of styrene oxide is C8H8O.
What is the molecular weight of styrene oxide?
The molecular weight of styrene oxide is 120.15 g/mol.
What are some synonyms of styrene oxide?
Some synonyms of styrene oxide include 2-Phenyloxirane, Phenyloxirane, and 1,2-Epoxyethylbenzene.
What is the IUPAC name of styrene oxide?
The IUPAC name of styrene oxide is 2-phenyloxirane.
What is the InChI of styrene oxide?
The InChI of styrene oxide is InChI=1S/C8H8O/c1-2-4-7(5-3-1)8-6-9-8/h1-5,8H,6H2.
What is the InChIKey of styrene oxide?
The InChIKey of styrene oxide is AWMVMTVKBNGEAK-UHFFFAOYSA-N.
What is the canonical SMILES of styrene oxide?
The canonical SMILES of styrene oxide is C1C(O1)C2=CC=CC=C2.
What is the CAS number of styrene oxide?
The CAS number of styrene oxide is 96-09-3.
What is the ChEMBL ID of styrene oxide?
The ChEMBL ID of styrene oxide is CHEMBL1605493.
How is styrene oxide classified by the International Agency for Research on Cancer (IARC)?
The International Agency for Research on Cancer (IARC) has classified styrene oxide as a Group 2A, a probable human carcinogen.