What is the molecular formula of Haloxyfop-P?
The molecular formula of Haloxyfop-P is C15H11ClF3NO4.
What are some synonyms of Haloxyfop-P?
Some synonyms of Haloxyfop-P include Haloxyfop-P [ISO], R-haloxyfop-acid, and (+)-haloxyfop.
What is the molecular weight of Haloxyfop-P?
The molecular weight of Haloxyfop-P is 361.70 g/mol.
How is the stereochemistry of Haloxyfop-P described?
Haloxyfop-P has an R configuration.
What is the main role of Haloxyfop-P?
Haloxyfop-P acts as a phenoxy herbicide and an agrochemical, as well as an EC 6.4.1.2 inhibitor.
What is the IUPAC name of Haloxyfop-P?
The IUPAC name of Haloxyfop-P is (2R)-2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid.
What is the InChIKey of Haloxyfop-P?
The InChIKey of Haloxyfop-P is GOCUAJYOYBLQRH-MRVPVSSYSA-N.
What is the canonical SMILES representation of Haloxyfop-P?
The canonical SMILES representation of Haloxyfop-P is CC(C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=N2)C(F)(F)F)Cl.
What is the CAS number of Haloxyfop-P?
The CAS number of Haloxyfop-P is 95977-29-0.
What are some computed properties of Haloxyfop-P?
Some computed properties of Haloxyfop-P include XLogP3-AA value of 4.2, 1 hydrogen bond donor count, 8 hydrogen bond acceptor count, and 5 rotatable bond count.
Download
![4H-Imidazo[4,5,1-kl][1]benzazocine,5,6,7,8-tetrahydro-8-methyl-(7ci)](https://resource.alfa-chemistry.com/structure/95979-98-9.gif)
