What is the molecular formula of 2-Methyl-d3-propyl alcohol?
The molecular formula is C4H10O.
What is the molecular weight of 2-Methyl-d3-propyl alcohol?
The molecular weight is 77.14 g/mol.
What is the IUPAC name of 2-Methyl-d3-propyl alcohol?
The IUPAC name is 3,3,3-trideuterio-2-methylpropan-1-ol.
What is the InChI of 2-Methyl-d3-propyl alcohol?
The InChI is InChI=1S/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3/i1D3.
What is the InChIKey of 2-Methyl-d3-propyl alcohol?
The InChIKey is ZXEKIIBDNHEJCQ-FIBGUPNXSA-N.
What is the canonical SMILES of 2-Methyl-d3-propyl alcohol?
The canonical SMILES is CC(C)CO.
What are the computed properties of 2-Methyl-d3-propyl alcohol?
The computed properties include molecular weight, XLogP3, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and compound canonicalization.
What is the XLogP3 value of 2-Methyl-d3-propyl alcohol?
The XLogP3 value is 0.8.
How many hydrogen bond donor counts does 2-Methyl-d3-propyl alcohol have?
It has 1 hydrogen bond donor count.
Is 2-Methyl-d3-propyl alcohol a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.