What is the molecular formula of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The molecular formula is C11H11NO3.
What is the PubChem CID of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The PubChem CID is 45791296.
What is the IUPAC name of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The IUPAC name is 2-(6-methyl-2-oxo-1,3-dihydroindol-3-yl)acetic acid.
What is the InChI of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The InChI is InChI=1S/C11H11NO3/c1-6-2-3-7-8(5-10(13)14)11(15)12-9(7)4-6/h2-4,8H,5H2,1H3,(H,12,15)(H,13,14).
What is the InChIKey of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The InChIKey is KKDSTULRLHTHJN-UHFFFAOYSA-N.
What is the canonical SMILES of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The canonical SMILES is CC1=CC2=C(C=C1)C(C(=O)N2)CC(=O)O.
What is the molecular weight of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The molecular weight is 205.21 g/mol.
What is the XLogP3-AA of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The XLogP3-AA is 0.7.
What is the hydrogen bond donor count of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of (6-Methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The hydrogen bond acceptor count is 3.