What is the molecular formula of Loxiol g 10?
The molecular formula of Loxiol g 10 is C21H40O4.
What is the molecular weight of Loxiol g 10?
The molecular weight of Loxiol g 10 is 356.5 g/mol.
What are the synonyms for Loxiol g 10?
The synonyms for Loxiol g 10 include Monoolein, 111-03-5, Glyceryl monooleate, 2,3-Dihydroxypropyl oleate, and 1-Monoolein.
What is the IUPAC name of Loxiol g 10?
The IUPAC name of Loxiol g 10 is 2,3-dihydroxypropyl (Z)-octadec-9-enoate.
What is the InChI of Loxiol g 10?
The InChI of Loxiol g 10 is InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-.
What is the InChIKey of Loxiol g 10?
The InChIKey of Loxiol g 10 is RZRNAYUHWVFMIP-KTKRTIGZSA-N.
What is the canonical SMILES of Loxiol g 10?
The canonical SMILES of Loxiol g 10 is CCCCCCCCCCCCCCCC(=O)OCC(CO)O.
What is the isomeric SMILES of Loxiol g 10?
The isomeric SMILES of Loxiol g 10 is CCCCCCCCC/C=C\CCCCCCCCC(=O)OCC(CO)O.
What is the CAS number of Loxiol g 10?
The CAS number of Loxiol g 10 is 111-03-5.
What is the FEMA number of Loxiol g 10?
The FEMA number of Loxiol g 10 is 2526.