The synonyms of the compound are: 959035-40-6 5-Pyrrolidin-2-ylidenemethyl-3,4-dihydropyrrol-2-one OXRTXEHELLIFHO-SREVYHEPSA-N 5-[(Z)-2-Pyrrolidinylidenemethyl]-3,4-dihydro-2H-pyrrol-2-one # 2-Pyrrolidinone,5-[(3,4-dihydro-2H-pyrrol-5-yl)methylene]-,(5Z)-.
What is the molecular weight of the compound?
The molecular weight of the compound is 164.20 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (5Z)-5-(3,4-dihydro-2H-pyrrol-5-ylmethylidene)pyrrolidin-2-one.
What is the InChI of the compound?
The InChI of the compound is "InChI=1S/C9H12N2O/c12-9-4-3-8(11-9)6-7-2-1-5-10-7/h6H,1-5H2,(H,11,12)/b8-6-".
What is the InChIKey of the compound?
The InChIKey of the compound is "VZVGTVNKWALTOW-VURMDHGXSA-N".
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is "C1CC(=NC1)C=C2CCC(=O)N2".
What is the isomeric SMILES of the compound?
The isomeric SMILES of the compound is "C1CC(=NC1)/C=C\2/CCC(=O)N2".
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.