What is the molecular formula of Chembrdg-bb 5904367?
The molecular formula of Chembrdg-bb 5904367 is C7H9N3O3.
When was Chembrdg-bb 5904367 created?
Chembrdg-bb 5904367 was created on July 9, 2005.
What is the IUPAC Name of Chembrdg-bb 5904367?
The IUPAC Name of Chembrdg-bb 5904367 is 1-(5-methyl-3-nitropyrazol-1-yl)propan-2-one.
What is the InChI Key of Chembrdg-bb 5904367?
The InChI Key of Chembrdg-bb 5904367 is QPBIALMZSYFKER-UHFFFAOYSA-N.
What is the Canonical SMILES of Chembrdg-bb 5904367?
The Canonical SMILES of Chembrdg-bb 5904367 is CC1=CC(=NN1CC(=O)C)[N+](=O)[O-].
What is the molecular weight of Chembrdg-bb 5904367?
The molecular weight of Chembrdg-bb 5904367 is 183.16 g/mol.
How many hydrogen bond donor counts does Chembrdg-bb 5904367 have?
Chembrdg-bb 5904367 has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Chembrdg-bb 5904367 have?
Chembrdg-bb 5904367 has 4 hydrogen bond acceptor counts.
What is the exact mass of Chembrdg-bb 5904367?
The exact mass of Chembrdg-bb 5904367 is 183.06439116 g/mol.
Is Chembrdg-bb 5904367 a canonicalized compound?
Yes, Chembrdg-bb 5904367 is a canonicalized compound.