What is the molecular formula of 3,4-Dichlorotoluene?
The molecular formula of 3,4-Dichlorotoluene is C7H6Cl2.
What is the molecular weight of 3,4-Dichlorotoluene?
The molecular weight of 3,4-Dichlorotoluene is 161.03 g/mol.
What is the IUPAC name of 3,4-Dichlorotoluene?
The IUPAC name of 3,4-Dichlorotoluene is 1,2-dichloro-4-methylbenzene.
What is the InChI code of 3,4-Dichlorotoluene?
The InChI code of 3,4-Dichlorotoluene is InChI=1S/C7H6Cl2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3.
What is the InChIKey of 3,4-Dichlorotoluene?
The InChIKey of 3,4-Dichlorotoluene is WYUIWKFIFOJVKW-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Dichlorotoluene?
The canonical SMILES of 3,4-Dichlorotoluene is CC1=CC(=C(C=C1)Cl)Cl.
What is the CAS number of 3,4-Dichlorotoluene?
The CAS number of 3,4-Dichlorotoluene is 95-75-0.
What is the XLogP3 value of 3,4-Dichlorotoluene?
The XLogP3 value of 3,4-Dichlorotoluene is 4.
How many hydrogen bond donor counts does 3,4-Dichlorotoluene have?
3,4-Dichlorotoluene has 0 hydrogen bond donor count.
How many rotatable bond counts does 3,4-Dichlorotoluene have?
3,4-Dichlorotoluene has 0 rotatable bond count.