What is the molecular formula of MK-3207?
The molecular formula of MK-3207 is C31H29F2N5O3.
What is the molecular weight of MK-3207?
The molecular weight of MK-3207 is 557.6 g/mol.
When was MK-3207 first created?
MK-3207 was first created in 2008-11-03.
What is the IUPAC name of MK-3207?
The IUPAC name of MK-3207 is 2-[(8R)-8-(3,5-difluorophenyl)-10-oxo-6,9-diazaspiro[4.5]decan-9-yl]-N-[(2R)-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl]acetamide.
What is the Canonical SMILES of MK-3207?
The Canonical SMILES of MK-3207 is C1CCC2(C1)C(=O)N(C(CN2)C3=CC(=CC(=C3)F)F)CC(=O)NC4=CC5=C(CC6(C5)C7=C(NC6=O)N=CC=C7)C=C4.
What is the InChIKey of MK-3207?
The InChIKey of MK-3207 is AZAANWYREOQRFB-SETSBSEESA-N.
What is the CAS number of MK-3207?
The CAS number of MK-3207 is 957118-49-9.
How many hydrogen bond donor counts does MK-3207 have?
MK-3207 has 3 hydrogen bond donor counts.
What is the topological polar surface area of MK-3207?
The topological polar surface area of MK-3207 is 103 Å2.
How many rotatable bond counts does MK-3207 have?
MK-3207 has 4 rotatable bond counts.