What is the molecular formula of Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl]?
The molecular formula is C7H5BBrF3O2.
How is the IUPAC name of Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl] computed?
The IUPAC name is computed as [2-bromo-5-(trifluoromethyl)phenyl]boronic acid.
What is the InChIKey of Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl]?
The InChIKey is MMCSHRKBEOIKBX-UHFFFAOYSA-N.
What is the Canonical SMILES of Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl]?
The Canonical SMILES is B(C1=C(C=CC(=C1)C(F)(F)F)Br)(O)O.
What is the molecular weight of Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl]?
The molecular weight is 268.83 g/mol.
How many hydrogen bond donor counts does Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl] have?
It has 2 hydrogen bond donor counts.
What is the hydrogen bond acceptor count of Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl]?
It has 5 hydrogen bond acceptor counts.
What is the exact mass and monoisotopic mass of Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl]?
The exact mass and monoisotopic mass is 267.95181 g/mol.
What is the topological polar surface area of Boronicacid,b-[2-bromo-5-(trifluoromethyl)phenyl]?
The topological polar surface area is 40.5 2.
Is the compound canonicalized?
Yes, the compound is canonicalized.