What is the molecular formula of 5-bromouridine?
The molecular formula of 5-bromouridine is C9H11BrN2O6.
What is the molecular weight of 5-bromouridine?
The molecular weight of 5-bromouridine is 323.10 g/mol.
What is the IUPAC name of 5-bromouridine?
The IUPAC name of 5-bromouridine is 5-bromo-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
What is the InChI of 5-bromouridine?
The InChI of 5-bromouridine is InChI=1S/C9H11BrN2O6/c10-3-1-12(9(17)11-7(3)16)8-6(15)5(14)4(2-13)18-8/h1,4-6,8,13-15H,2H2,(H,11,16,17)/t4-,5-,6-,8-/m1/s1.
What is the InChIKey of 5-bromouridine?
The InChIKey of 5-bromouridine is AGFIRQJZCNVMCW-UAKXSSHOSA-N.
What is the canonical SMILES of 5-bromouridine?
The canonical SMILES of 5-bromouridine is C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)Br.
What is the CAS number of 5-bromouridine?
The CAS number of 5-bromouridine is 957-75-5.
What is the molecular weight of 5-bromouridine according to PubChem?
The molecular weight of 5-bromouridine according to PubChem is 323.10 g/mol.
What is the XLogP3 value of 5-bromouridine?
The XLogP3 value of 5-bromouridine is -1.1.
How many hydrogen bond donor counts does 5-bromouridine have?
5-bromouridine has 4 hydrogen bond donor counts.