What is the PubChem CID for 4-Chlorochalcone?
The PubChem CID for 4-Chlorochalcone is 5377022.
What is the molecular formula of 4-Chlorochalcone?
The molecular formula of 4-Chlorochalcone is C15H11ClO.
What are some synonyms for 4-Chlorochalcone?
Some synonyms for 4-Chlorochalcone are 956-04-7, p-Chlorochalcone, (E)-3-(4-chlorophenyl)-1-phenylprop-2-en-1-one, and 3-(4-chlorophenyl)-1-phenylprop-2-en-1-one.
What is the molecular weight of 4-Chlorochalcone?
The molecular weight of 4-Chlorochalcone is 242.70 g/mol.
When was 4-Chlorochalcone created?
4-Chlorochalcone was created on March 26, 2005.
What is the IUPAC name of 4-Chlorochalcone?
The IUPAC name of 4-Chlorochalcone is (E)-3-(4-chlorophenyl)-1-phenylprop-2-en-1-one.
What is the InChI of 4-Chlorochalcone?
The InChI of 4-Chlorochalcone is InChI=1S/C15H11ClO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+.
What is the Canonical SMILES of 4-Chlorochalcone?
The Canonical SMILES of 4-Chlorochalcone is C1=CC=C(C=C1)C(=O)C=CC2=CC=C(C=C2)Cl.
What is the CAS number of 4-Chlorochalcone?
The CAS number of 4-Chlorochalcone is 956-04-7.
What is the XLogP3 value of 4-Chlorochalcone?
The XLogP3 value of 4-Chlorochalcone is 3.7.