What is the molecular formula of the compound with PubChem CID 523151?
The molecular formula is C8H9NO3.
What are the synonyms for the compound?
The synonyms for the compound are 3-Acetamido-5-acetylfuran, 95598-28-0, ACETAMIDE, N-(5-ACETYL-3-FURANYL)-, N-(5-acetylfuran-3-yl)acetamide, and N-(5-Acetyl-3-furyl)acetamide.
What is the molecular weight of the compound?
The molecular weight is 167.16 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-(5-acetylfuran-3-yl)acetamide.
What is the InChI of the compound?
The InChI is InChI=1S/C8H9NO3/c1-5(10)8-3-7(4-12-8)9-6(2)11/h3-4H,1-2H3,(H,9,11).
What is the InChIKey of the compound?
The InChIKey is GPLHPEIJJXDRBA-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is CC(=O)C1=CC(=CO1)NC(=O)C.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 0.2.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count is 3.
※ Please kindly note that our products are for research use only.