What is the molecular formula of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The molecular formula is C7H5N3O.
What is the molecular weight of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The molecular weight is 147.13 g/mol.
What is the IUPAC name of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The IUPAC name is 1H-pyrazolo[3,4-b]pyridine-5-carbaldehyde.
What is the InChI of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The InChI is InChI=1S/C7H5N3O/c11-4-5-1-6-3-9-10-7(6)8-2-5/h1-4H,(H,8,9,10).
What is the canonical SMILES of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The canonical SMILES is C1=C(C=NC2=C1C=NN2)C=O.
What is the CAS number of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The CAS number is 955127-76-1.
What is the European Community (EC) number of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The European Community (EC) number is 807-913-0.
What is the DSSTox Substance ID of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The DSSTox Substance ID is DTXSID10717152.
What is the XLogP3-AA value of 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde?
The XLogP3-AA value is 0.3.
Is 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde a canonicalized compound?
Yes, 1H-Pyrazolo[3,4-b]pyridine-5-carbaldehyde is a canonicalized compound.