955123-29-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H13N3O2S.
The molecular weight of the compound is 251.31 g/mol.
The IUPAC name of the compound is 4-(3,5-dimethylpyrazol-1-yl)benzenesulfonamide.
The InChI of the compound is InChI=1S/C11H13N3O2S/c1-8-7-9(2)14(13-8)10-3-5-11(6-4-10)17(12,15)16/h3-7H,1-2H3,(H2,12,15,16).
The InChIKey of the compound is BJJWJFXXXQZNIU-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC1=CC(=NN1C2=CC=C(C=C2)S(=O)(=O)N)C.
The CAS number of the compound is 955-15-7.
The XLogP3-AA value of the compound is 1.3.
The compound has 1 hydrogen bond donor count.
Yes, the compound is canonicalized according to PubChem.