What is the molecular formula of Benzhydryl acetate?
The molecular formula of Benzhydryl acetate is C15H14O2.
What is the molecular weight of Benzhydryl acetate?
The molecular weight of Benzhydryl acetate is 226.27 g/mol.
What is the IUPAC name of Benzhydryl acetate?
The IUPAC name of Benzhydryl acetate is benzhydryl acetate.
What is the Canonical SMILES of Benzhydryl acetate?
The Canonical SMILES of Benzhydryl acetate is CC(=O)OC(C1=CC=CC=C1)C2=CC=CC=C2.
How many hydrogen bond acceptors are there in Benzhydryl acetate?
There are 2 hydrogen bond acceptors in Benzhydryl acetate.
What is the topological polar surface area of Benzhydryl acetate?
The topological polar surface area of Benzhydryl acetate is 26.3 Å2.
Is Benzhydryl acetate a canonicalized compound?
Yes, Benzhydryl acetate is a canonicalized compound.
What is the exact mass of Benzhydryl acetate?
The exact mass of Benzhydryl acetate is 226.099379685 g/mol.
How many rotatable bond counts are there in Benzhydryl acetate?
There are 4 rotatable bond counts in Benzhydryl acetate.
What is the complexity value of Benzhydryl acetate?
The complexity value of Benzhydryl acetate is 219.