What is the molecular formula of 3,4-Dimethoxyphenyl 3-methoxyphenylacetate?
The molecular formula is C17H18O5.
When was 3,4-Dimethoxyphenyl 3-methoxyphenylacetate first created?
It was first created on 2009-09-25.
What is the IUPAC name of 3,4-Dimethoxyphenyl 3-methoxyphenylacetate?
The IUPAC name is (3,4-dimethoxyphenyl) 2-(3-methoxyphenyl)acetate.
What is the InChI of 3,4-Dimethoxyphenyl 3-methoxyphenylacetate?
The InChI is InChI=1S/C17H18O5/c1-19-13-6-4-5-12(9-13)10-17(18)22-14-7-8-15(20-2)16(11-14)21-3/h4-9,11H,10H2,1-3H3.
What is the InChIKey of 3,4-Dimethoxyphenyl 3-methoxyphenylacetate?
The InChIKey is AIIMMPRHKNZUJA-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 3,4-Dimethoxyphenyl 3-methoxyphenylacetate have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 3,4-Dimethoxyphenyl 3-methoxyphenylacetate?
The topological polar surface area is 54Ų.
How many rotatable bond counts does 3,4-Dimethoxyphenyl 3-methoxyphenylacetate have?
It has 7 rotatable bond counts.
What is the XLogP3-AA value of 3,4-Dimethoxyphenyl 3-methoxyphenylacetate?
The XLogP3-AA value is 3.2.
Is the compound canonicalized?
Yes, the compound is canonicalized.