What is the molecular formula of Asischem r42031?
The molecular formula of Asischem r42031 is C17H15NO.
When was Asischem r42031 created and last modified?
Asischem r42031 was created on 2005-07-28 and last modified on 2023-12-30.
What is the IUPAC name of Asischem r42031?
The IUPAC name of Asischem r42031 is 1-benzyl-2-methylindole-3-carbaldehyde.
What is the InChI of Asischem r42031?
The InChI of Asischem r42031 is InChI=1S/C17H15NO/c1-13-16(12-19)15-9-5-6-10-17(15)18(13)11-14-7-3-2-4-8-14/h2-10,12H,11H2,1H3.
What is the InChIKey of Asischem r42031?
The InChIKey of Asischem r42031 is LFRXDIWPLQSKBS-UHFFFAOYSA-N.
What is the Canonical SMILES of Asischem r42031?
The Canonical SMILES of Asischem r42031 is CC1=C(C2=CC=CC=C2N1CC3=CC=CC=C3)C=O.
What is the CAS ID of Asischem r42031?
The CAS ID of Asischem r42031 is 95202-45-2.
What is the molecular weight of Asischem r42031?
The molecular weight of Asischem r42031 is 249.31 g/mol.
How many hydrogen bond acceptor counts does Asischem r42031 have?
Asischem r42031 has 1 hydrogen bond acceptor count.
Is the compound of Asischem r42031 canonicalized?
Yes, the compound of Asischem r42031 is canonicalized.