What is the molecular formula of 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole?
The molecular formula is C11H6N4O4S.
What is the molecular weight of 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole?
The molecular weight is 290.26 g/mol.
What is the IUPAC name of 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole?
The IUPAC name is 5-nitro-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole.
What is the InChI of 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole?
The InChI is InChI=1S/C11H6N4O4S/c16-14(17)8-3-1-7(2-4-8)9-10(15(18)19)13-5-6-20-11(13)12-9/h1-6H.
What is the InChIKey of 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole?
The InChIKey is BRKUSHXUPGCTMP-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole?
The topological polar surface area is 137 Å2.
How many rotatable bond counts does 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole have?
It has 1 rotatable bond count.
Is 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole a canonicalized compound?
Yes, it is a canonicalized compound.
When was 5-nitro-6-(4-nitrophenyl)imidazo(2,1-b)thiazole last modified in the reference?
It was last modified on December 30, 2023.