CAS
950845-92-8 Purity
---
950845-92-8 Purity
---
Shopping basket
1H-Benzimidazole,1-(5-bromo-2-pyrazinyl)-5-methoxy-2-(trifluoromethyl)-
CAS
950845-98-4
Catalog Number
ACM950845984
Category
Other Products
Molecular Formula
C13H8BrF3N4O
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C13H8BrF3N4O.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-(5-bromopyrazin-2-yl)-5-methoxy-2-(trifluoromethyl)benzimidazole.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H8BrF3N4O/c1-22-7-2-3-9-8(4-7)20-12(13(15,16)17)21(9)11-6-18-10(14)5-19-11/h2-6H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is RRQKJLGOGVQXAC-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=CC2=C(C=C1)N(C(=N2)C(F)(F)F)C3=CN=C(C=N3)Br.
What is the molecular weight of the compound?
The molecular weight of the compound is 373.13 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.2.
How many hydrogen bond donor count does the compound have?
The compound has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does the compound have?
The compound has 7 hydrogen bond acceptor count.
How many rotatable bond count does the compound have?
The compound has 2 rotatable bond count.
Recommended Products
![5-[5-Methoxy-2-(trifluoromethyl)-1H-benzimidazol-1-yl]-2-pyrazinamine](https://resource.alfa-chemistry.com/structure/950845-99-5.gif)
CAS
950845-99-5 Purity
---
950845-99-5 Purity
---
CAS
950-86-7 Purity
---
950-86-7 Purity
---
