What is the molecular formula of 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy)?
The molecular formula is C18H17NO8.
What are some synonyms for 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy)?
Some synonyms include Resorufin galactopyranoside and Resorufin beta-D-galactopyranoside.
When was 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy) created and modified?
It was created on 2005-08-08 and modified on 2023-12-30.
What is the molecular weight of 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy)?
The molecular weight is 375.3 g/mol.
What is the InChIKey for 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy)?
The InChIKey is QULZFZMEBOATFS-DISONHOPSA-N.
What is the Canonical SMILES for 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy)?
The Canonical SMILES is C1=CC2=C(C=C1OC3C(C(C(C(O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2.
What is the CAS number for 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy)?
The CAS number is 95079-19-9.
What is the XLogP3-AA value for 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy)?
The XLogP3-AA value is -0.7.
How many hydrogen bond acceptors does 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy) have?
It has 9 hydrogen bond acceptors.
Is 3H-Phenoxazin-3-one, 7-(b-D-galactopyranosyloxy) considered to be canonicalized?
Yes, it is considered to be canonicalized.