What is the molecular formula of Decahydro-2-isopropenyl-8-methylazulene-4-methanol?
The molecular formula is C15H26O.
When was Decahydro-2-isopropenyl-8-methylazulene-4-methanol first created on PubChem?
It was first created on February 7, 2007.
What is the IUPAC name of Decahydro-2-isopropenyl-8-methylazulene-4-methanol?
The IUPAC name is (8-methyl-2-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-4-yl)methanol.
What is the InChIKey of Decahydro-2-isopropenyl-8-methylazulene-4-methanol?
The InChIKey is FESUBAPWUIYMFG-UHFFFAOYSA-N.
What is the Canonical SMILES of Decahydro-2-isopropenyl-8-methylazulene-4-methanol?
The Canonical SMILES is CC1CCCC(C2C1CC(C2)C(=C)C)CO.
What is the CAS number of Decahydro-2-isopropenyl-8-methylazulene-4-methanol?
The CAS number is 95044-44-3.
What is the molecular weight of Decahydro-2-isopropenyl-8-methylazulene-4-methanol?
The molecular weight is 222.37 g/mol.
How many hydrogen bond donor counts does Decahydro-2-isopropenyl-8-methylazulene-4-methanol have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Decahydro-2-isopropenyl-8-methylazulene-4-methanol?
The topological polar surface area is 20.2 Ų.
Is Decahydro-2-isopropenyl-8-methylazulene-4-methanol considered to be canonicalized on PubChem?
Yes, it is considered to be canonicalized on PubChem.