What is the molecular formula of 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea according to the reference?
The molecular formula is C17H14N4OS4.
What is the molecular weight of 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea?
The molecular weight is 418.6 g/mol.
When was 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea created according to the reference?
It was created on March 26, 2005.
What is the description of the physical appearance of 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea?
It is described as buff to light tan or light yellow powder.
What is the IUPAC name of 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea?
The IUPAC name is 1,3-bis(1,3-benzothiazol-2-ylsulfanylmethyl)urea.
What is the canonical SMILES of 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea?
The canonical SMILES is C1=CC=C2C(=C1)N=C(S2)SCNC(=O)NCSC3=NC4=CC=CC=C4S3.
How many hydrogen bond donor counts does 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea have?
It has 2 hydrogen bond donor counts.
What are the CAMEO Chemicals identifiers for 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea?
The CAMEO Chemicals identifiers include CAS numbers 64216-20-2 and 95-35-2.
What is the XLogP3-AA value of 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea?
The XLogP3-AA value is 5.6.
What is the topological polar surface area of 1,3-Bis(2-benzothiazolyl-mercaptomethyl)urea?
The topological polar surface area is 174Ų.