What is the PubChem CID of 2-Adamantanone oxime?
PubChem CID 64158.
What is the molecular formula of 2-Adamantanone oxime?
The molecular formula is C10H15NO.
What is the molecular weight of 2-Adamantanone oxime?
The molecular weight is 165.23 g/mol.
What is the IUPAC name of 2-Adamantanone oxime?
The IUPAC name is N-(2-adamantylidene)hydroxylamine.
What is the InChI code of 2-Adamantanone oxime?
The InChI code is InChI=1S/C10H15NO/c12-11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9,12H,1-5H2.
What is the InChIKey of 2-Adamantanone oxime?
The InChIKey is RABVIFXMFZFITE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Adamantanone oxime?
The canonical SMILES is C1C2CC3CC1CC(C2)C3=NO.
What is the CAS number of 2-Adamantanone oxime?
The CAS number is 4500-12-3.
What is the EC number of 2-Adamantanone oxime?
The EC number is 224-807-4.
Is 2-Adamantanone oxime a canonicalized compound?
Yes, 2-Adamantanone oxime is a canonicalized compound.