What is the molecular formula of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The molecular formula is C5H10N6O4.
What is the molecular weight of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The molecular weight is 218.17 g/mol.
What is the IUPAC name of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The IUPAC name is 3,7-dinitro-1,3,5,7-tetrazabicyclo[3.3.1]nonane.
What is the InChI of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The InChI is InChI=1S/C5H10N6O4/c12-10(13)8-2-6-1-7(4-8)5-9(3-6)11(14)15/h1-5H2.
What is the InChIKey of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The InChIKey is UOYIYWCAYFTQLH-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The Canonical SMILES is C1N2CN(CN1CN(C2)[N+](=O)[O-])[N+](=O)[O-].
What is the CAS number of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The CAS number is 949-56-4.
What is the European Community (EC) number of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The EC number is 213-441-0.
What is the DSSTox Substance ID of 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane?
The DSSTox Substance ID is DTXSID10915232.
Is 3,7-dinitro-1,3,5,7-tetraazabicyclo[3.3.1]nonane a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.