What is the molecular formula of Fmoc-D-ala(1-pyrazolyl)-oh?
The molecular formula of Fmoc-D-ala(1-pyrazolyl)-oh is C21H19N3O4.
What is the molecular weight of Fmoc-D-ala(1-pyrazolyl)-oh?
The molecular weight of Fmoc-D-ala(1-pyrazolyl)-oh is 377.4 g/mol.
What is the IUPAC name of Fmoc-D-ala(1-pyrazolyl)-oh?
The IUPAC name of Fmoc-D-ala(1-pyrazolyl)-oh is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrazol-1-ylpropanoic acid.
What is the InChI of Fmoc-D-ala(1-pyrazolyl)-oh?
The InChI of Fmoc-D-ala(1-pyrazolyl)-oh is InChI=1S/C21H19N3O4/c25-20(26)19(12-24-11-5-10-22-24)23-21(27)28-13-18-16-8-3-1-6-14(16)15-7-2-4-9-17(15)18/h1-11,18-19H,12-13H2,(H,23,27)(H,25,26)/t19-/m1/s1.
What is the InChIKey of Fmoc-D-ala(1-pyrazolyl)-oh?
The InChIKey of Fmoc-D-ala(1-pyrazolyl)-oh is LFIMKADLAIDVGC-LJQANCHMSA-N.
What is the canonical SMILES of Fmoc-D-ala(1-pyrazolyl)-oh?
The canonical SMILES of Fmoc-D-ala(1-pyrazolyl)-oh is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CN4C=CC=N4)C(=O)O.
What is the XLogP3-AA value of Fmoc-D-ala(1-pyrazolyl)-oh?
The XLogP3-AA value of Fmoc-D-ala(1-pyrazolyl)-oh is 2.6.
How many hydrogen bond acceptor counts does Fmoc-D-ala(1-pyrazolyl)-oh have?
Fmoc-D-ala(1-pyrazolyl)-oh has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does Fmoc-D-ala(1-pyrazolyl)-oh have?
Fmoc-D-ala(1-pyrazolyl)-oh has 7 rotatable bond counts.
※ Please kindly note that our products are for research use only.