What is the molecular formula of 6,7-Dichloro-4-hydroxy-2-methylquinoline?
The molecular formula is C10H7Cl2NO.
When was 6,7-Dichloro-4-hydroxy-2-methylquinoline first created in PubChem?
It was first created on November 13, 2007.
What is the IUPAC name of 6,7-Dichloro-4-hydroxy-2-methylquinoline?
The IUPAC name is 6,7-dichloro-2-methyl-1H-quinolin-4-one.
What is the InChIKey of 6,7-Dichloro-4-hydroxy-2-methylquinoline?
The InChIKey is XZAAGMJDSBHAKQ-UHFFFAOYSA-N.
What is the canonical SMILES representation of 6,7-Dichloro-4-hydroxy-2-methylquinoline?
The canonical SMILES representation is CC1=CC(=O)C2=CC(=C(C=C2N1)Cl)Cl.
What is the molecular weight of 6,7-Dichloro-4-hydroxy-2-methylquinoline?
The molecular weight is 228.07 g/mol.
How many hydrogen bond donor counts does 6,7-Dichloro-4-hydroxy-2-methylquinoline have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 6,7-Dichloro-4-hydroxy-2-methylquinoline?
The topological polar surface area is 29.1 Ų.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.
How many rotatable bond counts does 6,7-Dichloro-4-hydroxy-2-methylquinoline have?
It has 0 rotatable bond counts.