What is the molecular formula of 3-Chloromethyl-2,6-dichloro-8-methylquinoline?
The molecular formula is C11H8Cl3N.
What is the molecular weight of 3-Chloromethyl-2,6-dichloro-8-methylquinoline?
The molecular weight is 260.5 g/mol.
What is the IUPAC name of 3-Chloromethyl-2,6-dichloro-8-methylquinoline?
The IUPAC name is 2,6-dichloro-3-(chloromethyl)-8-methylquinoline.
What is the InChI of 3-Chloromethyl-2,6-dichloro-8-methylquinoline?
The InChI is InChI=1S/C11H8Cl3N/c1-6-2-9(13)4-7-3-8(5-12)11(14)15-10(6)7/h2-4H,5H2,1H3.
What is the InChIKey of 3-Chloromethyl-2,6-dichloro-8-methylquinoline?
The InChIKey is XVJPSHJXHVPAID-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chloromethyl-2,6-dichloro-8-methylquinoline?
The canonical SMILES is CC1=CC(=CC2=CC(=C(N=C12)Cl)CCl)Cl.
What is the XLogP3-AA value of 3-Chloromethyl-2,6-dichloro-8-methylquinoline?
The XLogP3-AA value is 4.5.
How many hydrogen bond acceptors does 3-Chloromethyl-2,6-dichloro-8-methylquinoline have?
It has 1 hydrogen bond acceptor.
What is the topological polar surface area of 3-Chloromethyl-2,6-dichloro-8-methylquinoline?
The topological polar surface area is 12.92.
Is the compound canonicalized according to PubChem?
Yes, the compound is canonicalized.