What is the molecular formula of 2-Chloro-3-chloromethyl-6,8-dimethylquinoline?
The molecular formula is C12H11Cl2N.
When was 2-Chloro-3-chloromethyl-6,8-dimethylquinoline created and last modified?
It was created on November 13, 2007, and last modified on December 30, 2023.
What is the IUPAC name of 2-Chloro-3-chloromethyl-6,8-dimethylquinoline?
The IUPAC name is 2-chloro-3-(chloromethyl)-6,8-dimethylquinoline.
What is the InChI of 2-Chloro-3-chloromethyl-6,8-dimethylquinoline?
The InChI is InChI=1S/C12H11Cl2N/c1-7-3-8(2)11-9(4-7)5-10(6-13)12(14)15-11/h3-5H,6H2,1-2H3.
What is the InChIKey of 2-Chloro-3-chloromethyl-6,8-dimethylquinoline?
The InChIKey is CWSRGSBHXSKFHH-UHFFFAOYSA-N.
How much does 2-Chloro-3-chloromethyl-6,8-dimethylquinoline weigh?
It weighs 240.12 g/mol.
What is the Canonical SMILES of 2-Chloro-3-chloromethyl-6,8-dimethylquinoline?
The Canonical SMILES is CC1=CC(=C2C(=C1)C=C(C(=N2)Cl)CCl)C.
How many hydrogen bond donor counts are there in 2-Chloro-3-chloromethyl-6,8-dimethylquinoline?
There are 0 hydrogen bond donor counts.
What is the topological polar surface area of 2-Chloro-3-chloromethyl-6,8-dimethylquinoline?
The topological polar surface area is 12.9 Ų.
Is 2-Chloro-3-chloromethyl-6,8-dimethylquinoline a canonicalized compound?
Yes, the compound is canonicalized.