What is the molecular formula of 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester?
The molecular formula is C16H17NO4.
When was the structure of 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester first created?
The structure was first created on 2007-11-13.
What is the molecular weight of 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester?
The molecular weight is 287.31 g/mol.
What is the IUPAC name of 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester?
The IUPAC name is diethyl 6-methylquinoline-2,3-dicarboxylate.
What is the Canonical SMILES of 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester?
The Canonical SMILES is CCOC(=O)C1=C(N=C2C=CC(=CC2=C1)C)C(=O)OCC.
What is the InChIKey of 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester?
The InChIKey is FMXXGQSZIJSYQR-UHFFFAOYSA-N.
How many hydrogen bond acceptors are present in 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester?
There are 5 hydrogen bond acceptors.
What is the topological polar surface area of 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester?
The topological polar surface area is 65.5 Ų.
How many rotatable bond counts are there in 6-Methylquinoline-2,3-dicarboxylic acid diethyl ester?
There are 6 rotatable bond counts.
Is the compound canonicalized according to PubChem?
Yes, the compound is canonicalized according to PubChem.