What is the molecular formula of 3-Cyano-7-Chloroindole?
The molecular formula of 3-Cyano-7-Chloroindole is C9H5ClN2.
When was 3-Cyano-7-Chloroindole first created and modified in PubChem?
3-Cyano-7-Chloroindole was created on 2009-05-28 and modified on 2023-12-30 in PubChem.
What is the IUPAC Name of 3-Cyano-7-Chloroindole?
The IUPAC Name of 3-Cyano-7-Chloroindole is 7-chloro-1H-indole-3-carbonitrile.
What is the InChIKey of 3-Cyano-7-Chloroindole?
The InChIKey of 3-Cyano-7-Chloroindole is OEVSYHNNZOKQFD-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 3-Cyano-7-Chloroindole?
The Canonical SMILES representation of 3-Cyano-7-Chloroindole is C1=CC2=C(C(=C1)Cl)NC=C2C#N.
What is the CAS number of 3-Cyano-7-Chloroindole?
The CAS number of 3-Cyano-7-Chloroindole is 948015-64-3.
What is the molecular weight of 3-Cyano-7-Chloroindole?
The molecular weight of 3-Cyano-7-Chloroindole is 176.60 g/mol.
How many hydrogen bond donor counts does 3-Cyano-7-Chloroindole have?
3-Cyano-7-Chloroindole has 1 hydrogen bond donor count.
What is the formal charge of 3-Cyano-7-Chloroindole?
The formal charge of 3-Cyano-7-Chloroindole is 0.
Is 3-Cyano-7-Chloroindole a canonicalized compound?
Yes, 3-Cyano-7-Chloroindole is a canonicalized compound.