What is the molecular formula of Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate?
The molecular formula is C11H7F15O3.
When was Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate created and modified?
It was created on 2010-03-29 and modified on 2023-12-30.
What is the IUPAC name of Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate?
The IUPAC name is propyl 2,2,3,3,4,4,5,5-octafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentanoate.
What is the InChI of Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate?
The InChI is InChI=1S/C11H7F15O3/c1-2-3-28-4(27)5(12,13)6(14,15)7(16,17)11(25,26)29-8(18,9(19,20)21)10(22,23)24/h2-3H2,1H3.
What is the Canonical SMILES of Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate?
The Canonical SMILES is CCCOC(=O)C(C(C(C(OC(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(F)F.
What is the molecular weight of Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate?
The molecular weight is 472.15 g/mol.
How many hydrogen bond acceptor counts does Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate have?
It has 18 hydrogen bond acceptor counts.
What is the topological polar surface area of Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate?
The topological polar surface area is 35.5 ㎡.
How many rotatable bond counts does Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate have?
It has 9 rotatable bond counts.
Is Propyl 5-(heptafluoroisopropoxy)octafluoropentanoate a canonicalized compound?
Yes, it is a canonicalized compound.