What is the molecular formula of Azulene, 4-(iodomethyl)-?
The molecular formula is C11H9I.
When was the structure of Azulene, 4-(iodomethyl)- created?
The structure was created on July 19, 2005.
What is the IUPAC Name of Azulene, 4-(iodomethyl)-?
The IUPAC Name is 4-(iodomethyl)azulene.
What is the InChI of Azulene, 4-(iodomethyl)-?
The InChI is InChI=1S/C11H9I/c12-8-10-5-2-1-4-9-6-3-7-11(9)10/h1-7H,8H2.
What is the InChIKey of Azulene, 4-(iodomethyl)-?
The InChIKey is FGSKQLOAIUDGNE-UHFFFAOYSA-N.
What is the Canonical SMILES of Azulene, 4-(iodomethyl)-?
The Canonical SMILES is C1=CC=C(C2=CC=CC2=C1)CI.
What is the molecular weight of Azulene, 4-(iodomethyl)-?
The molecular weight is 268.09 g/mol.
How many hydrogen bond donor counts does Azulene, 4-(iodomethyl)- have?
Azulene, 4-(iodomethyl)- has 0 hydrogen bond donor counts.
What is the topological polar surface area of Azulene, 4-(iodomethyl)-?
The topological polar surface area is 0-2.
Is the compound canonicalized for Azulene, 4-(iodomethyl)-?
Yes, the compound is canonicalized.