947590-65-0 Purity
---
If you have any other questions or need other size, please get a quote.
The IUPAC name of the compound is 5-(bromomethyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-thiadiazole.
The InChI of the compound is InChI=1S/C10H6BrF3N2S/c11-5-8-15-9(16-17-8)6-1-3-7(4-2-6)10(12,13)14/h1-4H,5H2.
The InChIKey of the compound is HSHZPGGCSUPGLY-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC=C1C2=NSC(=N2)CBr)C(F)(F)F.
The molecular weight of the compound is 323.13 g/mol.
The XLogP3-AA value of the compound is 3.9.
There are no hydrogen bond donor atoms present in the compound.
There are 6 hydrogen bond acceptor atoms present in the compound.
There are 2 rotatable bonds present in the compound.
The topological polar surface area of the compound is 54.2.