CAS
947536-74-5 Purity
---
947536-74-5 Purity
---
![4-Chloro-[[2-[[[(1,1-dimethylethoxy)carbonyl]amino]iminomethyl]benzo[b]thien-6-yl]oxy]-benzeneacetic acid methyl ester](https://resource.alfa-chemistry.com/structure/947590-61-6.gif)
Shopping basket
2-[(1-Methylethyl)amino]butanoic acid methyl ester hydrochloride
CAS
947586-41-6
Catalog Number
ACM947586416
Category
Other Products
Molecular Weight
195.69
Molecular Formula
C8H17NO2.HCl
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC Name of the compound?
The IUPAC Name of the compound is methyl 2-(propan-2-ylamino)butanoate;hydrochloride.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H18ClNO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 195.69 g/mol.
What is the parent compound of the compound?
The parent compound of the compound is CID 59000478 (Methyl 2-(isopropylamino)butanoate).
What are the synonyms of the compound?
The synonyms of the compound are 947586-41-6, 2-[(1-methylethyl)amino]butanoic acid methyl ester hydrochloride, methyl 2-(propan-2-ylamino)butanoate;hydrochloride, Hydrochloride 2-((1-methylethyl)amino)butanoic acid methyl ester hcl.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H17NO2.ClH/c1-5-7(8(10)11-4)9-6(2)3;/h6-7,9H,5H2,1-4H3;1H.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 5 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![Dimethyl bicyclo[2,2,1]2,5-heptadiene-2,3-dicarboxylate](https://resource.alfa-chemistry.com/structure/947-57-9.gif)
CAS
947586-93-8 Purity
96%
947586-93-8 Purity
96%
![6-(Allyloxy)benzo[b]thiophene-2-carbonitrile](https://resource.alfa-chemistry.com/structure/947590-62-7.gif)
