947534-32-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 5-bromo-1,2-difluoro-3-prop-2-enoxybenzene.
The molecular formula of the compound is C9H7BrF2O.
The molecular weight of the compound is 249.05 g/mol.
The CAS number of the compound is 947534-35-2.
The InChI of the compound is InChI=1S/C9H7BrF2O/c1-2-3-13-8-5-6(10)4-7(11)9(8)12/h2,4-5H,1,3H2.
The InChIKey of the compound is ASDVXCCTIAJHMS-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C=CCOC1=C(C(=CC(=C1)Br)F)F.
The XLogP3-AA value of the compound is 3.4.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.