What is the molecular formula of 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine?
The molecular formula is C13H8BrN3O2.
What is the PubChem CID for 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine?
The PubChem CID is 45158650.
When was 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine created in PubChem?
It was created on April 27, 2010.
When was 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine last modified in PubChem?
It was last modified on December 30, 2023.
What is the IUPAC name of 5-Bromo-2-(4-nitrophenyl)imidazo[1,2-a]pyridine?
The IUPAC name is 5-bromo-2-(4-nitrophenyl)imidazo[1,2-a]pyridine.
What is the InChI of 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine?
The InChI is InChI=1S/C13H8BrN3O2/c14-12-2-1-3-13-15-11(8-16(12)13)9-4-6-10(7-5-9)17(18)19/h1-8H.
What is the InChIKey of 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine?
The InChIKey is CGZYETRIQIXGMV-UHFFFAOYSA-N.
What is the canonical SMILES representation of 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine?
The canonical SMILES is C1=CC2=NC(=CN2C(=C1)Br)C3=CC=C(C=C3)[N+](=O)[O-].
What is the CAS number for 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine?
The CAS number is 947533-84-8.
What is the molecular weight of 5-Bromo-2-(4-nitro-phenyl)-imidazo[1,2-a]pyridine?
The molecular weight is 318.12 g/mol.