What is the molecular formula of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The molecular formula of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is C10H9F2IO3.
What are the synonyms of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The synonyms of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester are 947533-66-6, DIFLUORO-(3-IODO-PHENOXY)-ACETIC ACID ETHYL ESTER, DTXSID40700890, and AKOS015150697.
What is the molecular weight of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The molecular weight of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is 342.08 g/mol.
What is the IUPAC name of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The IUPAC name of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is ethyl 2,2-difluoro-2-(3-iodophenoxy)acetate.
What is the InChI identifier of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The InChI identifier of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is InChI=1S/C10H9F2IO3/c1-2-15-9(14)10(11,12)16-8-5-3-4-7(13)6-8/h3-6H,2H2,1H3.
What is the InChIKey of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The InChIKey of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is ZAFJIBCFMZIJGL-UHFFFAOYSA-N.
What is the canonical SMILES of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The canonical SMILES of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is CCOC(=O)C(OC1=CC(=CC=C1)I)(F)F.
What is the CAS number of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The CAS number of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is 947533-66-6.
What is the XLogP3-AA value of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester?
The XLogP3-AA value of Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is 3.6.
Is Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester a canonicalized compound?
Yes, Difluoro-(3-iodo-phenoxy)-acetic acid ethyl ester is a canonicalized compound.
※ Please kindly note that our products are for research use only.