What is the molecular formula of (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde?
The molecular formula is C17H24N2O3.
What is the synonyms of (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde?
The synonyms include 947275-36-7, (S)-tert-butyl 4-benzyl-2-formylpiperazine-1-carboxylate, and TERT-BUTYL (2S)-4-BENZYL-2-FORMYLPIPERAZINE-1-CARBOXYLATE.
What is the molecular weight of (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde?
The molecular weight is 304.4 g/mol.
When was (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde created and last modified?
It was created on September 8, 2009, and last modified on December 30, 2023.
What is the IUPAC Name of (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde?
The IUPAC Name is tert-butyl (2S)-4-benzyl-2-formylpiperazine-1-carboxylate.
What is the InChIKey of (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde?
The InChIKey is BHZMIMWLXCEQDL-HNNXBMFYSA-N.
What is the canonical SMILES of (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde?
The canonical SMILES is CC(C)(C)OC(=O)N1CCN(CC1C=O)CC2=CC=CC=C2.
How many hydrogen bond acceptors does (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde have?
It has 4 hydrogen bond acceptors.
What is the exact mass of (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde?
The exact mass is 304.17869263 g/mol.
Is (S)-1-Boc-4-benzylpiperazine-2-carbaldehyde a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.