What is the PubChem CID for Palmatine chloride?
PubChem CID 73442.
What is the molecular formula of Palmatine chloride?
The molecular formula is C21H22ClNO4.
What is the molecular weight of Palmatine chloride?
The molecular weight is 387.9 g/mol.
What is the IUPAC Name of Palmatine chloride?
The IUPAC Name is 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;chloride.
What is the InChI of Palmatine chloride?
The InChI is InChI=1S/C21H22NO4.ClH/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4;/h5-6,9-12H,7-8H2,1-4H3;1H/q+1;/p-1.
What is the InChIKey of Palmatine chloride?
The InChIKey is RLQYRXCUPVKSAW-UHFFFAOYSA-M.
What is the canonical SMILES of Palmatine chloride?
The canonical SMILES is COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC).[Cl-].
What is the CAS number of Palmatine chloride?
The CAS number is 10605-02-4.
What is the hydrogen bond donor count of Palmatine chloride?
The hydrogen bond donor count is 0.