What is the molecular formula of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The molecular formula is C7H6BrNO2.
What are the synonyms of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The synonyms include 6-Bromo-3-methoxypicolinaldehyde, 945954-95-0, 6-bromo-3-methoxypyridine-2-carbaldehyde, and 6-Bromo-3-methoxy-2-pyridinecarboxaldehyde.
What is the molecular weight of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The molecular weight is 216.03 g/mol.
What is the IUPAC name of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The IUPAC name is 6-bromo-3-methoxypyridine-2-carbaldehyde.
What is the InChI code of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The InChI code is InChI=1S/C7H6BrNO2/c1-11-6-2-3-7(8)9-5(6)4-10/h2-4H,1H3.
What is the InChIKey of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The InChIKey is ATJHFXRPMHJWAT-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The Canonical SMILES is COC1=C(N=C(C=C1)Br)C=O.
What is the CAS number of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The CAS number is 945954-95-0.
What is the XLogP3-AA value of 6-Bromo-3-methoxypyridine-2-carboxaldehyde?
The XLogP3-AA value is 1.6.
Does 6-Bromo-3-methoxypyridine-2-carboxaldehyde have any hydrogen bond donor or acceptor count?
It has 0 hydrogen bond donor count and 3 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.