What is the molecular formula of Phytantriol?
The molecular formula of Phytantriol is C20H42O3.
What is the molecular weight of Phytantriol?
The molecular weight of Phytantriol is 330.5 g/mol.
What are some synonyms for Phytantriol?
Some synonyms for Phytantriol are 3,7,11,15-Tetramethylhexadecane-1,2,3-triol and 3,7,11,15-TETRAMETHYL-1,2,3-HEXADECANETRIOL.
When was Phytantriol created and last modified?
Phytantriol was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of Phytantriol?
The IUPAC name of Phytantriol is 3,7,11,15-tetramethylhexadecane-1,2,3-triol.
What is the Canonical SMILES representation of Phytantriol?
The Canonical SMILES representation of Phytantriol is CC(C)CCCC(C)CCCC(C)CCCC(C)(C(CO)O)O.
What is the InChIKey of Phytantriol?
The InChIKey of Phytantriol is CGIHFIDULQUVJG-UHFFFAOYSA-N.
What is the European Community (EC) Number of Phytantriol?
The European Community (EC) Number of Phytantriol is 277-923-2.
How many hydrogen bond donor counts does Phytantriol have?
Phytantriol has 3 hydrogen bond donor counts.
What is the topological polar surface area of Phytantriol?
The topological polar surface area of Phytantriol is 60.7 Å2.
How many hydrogen bond acceptor counts does Phytantriol have?
Phytantriol has 3 hydrogen bond acceptor counts.
What is the exact mass of Phytantriol?
The exact mass of Phytantriol is 330.31339520 g/mol.
How many rotatable bond counts does Phytantriol have?
Phytantriol has 14 rotatable bond counts.
How many heavy atoms does Phytantriol have?
Phytantriol has 23 heavy atoms.
Does Phytantriol have any defined atom stereocenter counts?
No, Phytantriol does not have any defined atom stereocenter counts.
What is the formal charge of Phytantriol?
The formal charge of Phytantriol is 0.