What is the IUPAC name of Akos bc-0609?
The IUPAC name of Akos bc-0609 is methyl 2-(4-aminophenyl)quinoline-4-carboxylate.
What is the molecular formula of Akos bc-0609?
The molecular formula of Akos bc-0609 is C17H14N2O2.
What is the molecular weight of Akos bc-0609?
The molecular weight of Akos bc-0609 is 278.30 g/mol.
What is the CAS number of Akos bc-0609?
The CAS number of Akos bc-0609 is 94541-55-6.
What is the InChI of Akos bc-0609?
The InChI of Akos bc-0609 is InChI=1S/C17H14N2O2/c1-21-17(20)14-10-16(11-6-8-12(18)9-7-11)19-15-5-3-2-4-13(14)15/h2-10H,18H2,1H3.
What is the InChIKey of Akos bc-0609?
The InChIKey of Akos bc-0609 is SLJVLRVWOJQKEM-UHFFFAOYSA-N.
What is the XLogP3-AA value of Akos bc-0609?
The XLogP3-AA value of Akos bc-0609 is 3.
How many hydrogen bond donor counts does Akos bc-0609 have?
Akos bc-0609 has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Akos bc-0609 have?
Akos bc-0609 has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Akos bc-0609 have?
Akos bc-0609 has 3 rotatable bond counts.