What is the molecular formula of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol?
The molecular formula is C6H10N4O.
What is the molecular weight of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol?
The molecular weight is 154.17 g/mol.
What is the IUPAC name of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol?
The IUPAC name is 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-ylmethanol.
What is the InChI of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol?
The InChI is InChI=1S/C6H10N4O/c11-4-6-9-8-5-3-7-1-2-10(5)6/h7,11H,1-4H2.
What is the InChIKey of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol?
The InChIKey is CDGXEUWHBCAHIJ-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol?
The canonical SMILES is C1CN2C(=NN=C2CO)CN1.
What is the CAS number of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol?
The CAS number is 945262-31-7.
What is the European Community (EC) Number of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol?
The European Community (EC) Number is 820-974-8.
What is the molecular weight of 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol according to PubChem 2.1?
The molecular weight is 154.17 g/mol.
Is 1,2,4-Triazolo[4,3-a]pyrazine-3-methanol a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.