What is the molecular formula of 7-Trifluoromethyl-imidazo[1,2-a]pyridine?
The molecular formula is C8H5F3N2.
When was the structure of 7-Trifluoromethyl-imidazo[1,2-a]pyridine created and modified?
It was created on May 30, 2009, and modified on December 30, 2023.
What is the IUPAC name of 7-Trifluoromethyl-imidazo[1,2-a]pyridine?
The IUPAC name is 7-(trifluoromethyl)imidazo[1,2-a]pyridine.
What is the InChI key of 7-Trifluoromethyl-imidazo[1,2-a]pyridine?
The InChI key is TUPNGOKBBWGSGZ-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Trifluoromethyl-imidazo[1,2-a]pyridine?
The canonical SMILES is C1=CN2C=CN=C2C=C1C(F)(F)F.
How many hydrogen bond donor counts does 7-Trifluoromethyl-imidazo[1,2-a]pyridine have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 7-Trifluoromethyl-imidazo[1,2-a]pyridine?
The topological polar surface area is 17.3 Ų.
Is 7-Trifluoromethyl-imidazo[1,2-a]pyridine a covalently-bonded unit?
Yes, it is a covalently-bonded unit.
How many defined atom stereocenter counts does 7-Trifluoromethyl-imidazo[1,2-a]pyridine have?
It has 0 defined atom stereocenter counts.
What is the molecular weight of 7-Trifluoromethyl-imidazo[1,2-a]pyridine?
The molecular weight is 186.13 g/mol.