944451-32-5 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula is C11H15N5O5.
The molecular weight is 297.27 g/mol.
The IUPAC name is 1-[(2S,3R,4R,5S)-2-(azidomethyl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-5-methylpyrimidine-2,4-dione.
CC1=CN(C(=O)NC1=O)C2C(OC(C2O)CO)CN=[N+]=[N-]
There are 3 hydrogen bond donor counts.
The hydrogen bond acceptor count is 7.
The exact mass is 297.10731860 g/mol.
The topological polar surface area is 114 Ų.
There are 21 heavy atoms in the compound.
Yes, the defined atom stereocenter count is 4.