CAS
944284-86-0 Purity
96%
944284-86-0 Purity
96%
Shopping basket
Pyridine,4-methyl-5-nitro-2-(trifluoromethyl)-
CAS
944317-53-7
Catalog Number
ACM944317537
Category
Other Products
Molecular Formula
C7H5F3N2O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C7H5F3N2O2.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-methyl-5-nitro-2-(trifluoromethyl)pyridine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H5F3N2O2/c1-4-2-6(7(8,9)10)11-3-5(4)12(13)14/h2-3H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is YAVOZQHDJFJNPM-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC(=NC=C1[N+](=O)[O-])C(F)(F)F.
What is the molecular weight of the compound?
The molecular weight of the compound is 206.12 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 6 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 0 rotatable bond counts.
Recommended Products
![2-[(3-Methoxyphenyl)phenylamino]acetonitrile](https://resource.alfa-chemistry.com/structure/944284-86-0.gif)
